fosmet-oxon

https://data.omgeving.vlaanderen.be/id/concept/chemische_stof/BEMXOWRVWRNPPL-UHFFFAOYSA-N

Browse codelijst preferred label fosmet-oxon type Concept chemical compound chemical substance drug CAS number 3735-33-9 IUPAC name 2-(dimethoxyphosphorylsulfanylmethyl)isoindole-1,3-dione InChIKey BEMXOWRVWRNPPL-UHFFFAOYSA-N SMILES COP(=O)(OC)SCN1C(=O)C2=CC=CC=C2C1=O definition This compound belongs to the class of organic compounds known as phthalimides. These are aromatic heterocyclic compounds containing a 1,3-dioxoisoindoline moiety. They are imide derivatives of phthalic anhydrides. notation fosmOon note This compound belongs to the class of organic compounds known as phthalimides. These are aromatic heterocyclic compounds containing a 1,3-dioxoisoindoline moiety. They are imide derivatives of phthalic anhydrides. relation Azacyclic compounds Benzenoids Carboxylic acid derivatives Carboxylic acid imides Carboxylic acids and derivatives Chemical entities Hydrocarbon derivatives Isoindoles Isoindoles and derivatives Isoindolines Isoindolones N-substituted carboxylic acid imides Organic acids and derivatives Organic compounds Organic nitrogen compounds Organic oxides Organic oxygen compounds Organoheterocyclic compounds Organonitrogen compounds Organooxygen compounds Organophosphorus compounds Organopnictogen compounds Organosulfur compounds Organothiophosphorus compounds Phthalimides Sulfenyl compounds PubChem http://rdf.ncbi.nlm.nih.gov/pubchem/compound/CID77323 broader Phthalimides broaderTransitive Chemical entities Isoindoles and derivatives Isoindolines Isoindolones Organic compounds Organoheterocyclic compounds Phthalimides is in scheme Conceptschema Chemische Stoffen semanticRelation Azacyclic compounds Benzenoids Chemical entities Hydrocarbon derivatives Isoindoles Isoindoles and derivatives Isoindolines Isoindolones N-substituted carboxylic acid imides Organic compounds Organic oxides Organoheterocyclic compounds Organonitrogen compounds Organooxygen compounds Organopnictogen compounds Organothiophosphorus compounds Phthalimides Sulfenyl compounds semanticRelation narrowerTransitive narrower isDefinedBy Via content negotiation https://data.omgeving.vlaanderen.be/doc/concept/chemische_stof/BEMXOWRVWRNPPL-UHFFFAOYSA-N.jsonld https://data.omgeving.vlaanderen.be/doc/concept/chemische_stof/BEMXOWRVWRNPPL-UHFFFAOYSA-N.nt https://data.omgeving.vlaanderen.be/doc/concept/chemische_stof/BEMXOWRVWRNPPL-UHFFFAOYSA-N.rdf https://data.omgeving.vlaanderen.be/doc/concept/chemische_stof/BEMXOWRVWRNPPL-UHFFFAOYSA-N.ttl page https://data.omgeving.vlaanderen.be/doc/concept/chemische_stof/BEMXOWRVWRNPPL-UHFFFAOYSA-N.html